| Name | Benzo(b)thiophene-2-carboxylic acid |
| Synonyms | AKOS 92498 BUTTPARK 8618-03 RARECHEM AL BE 0483 TIMTEC-BB SBB003763 1-benzothiophene-2-carboxylate THIANAPHTHENE-2-CARBOXYLIC ACID Thianaphthene-2-carboxylic acid BENZOTHIOPHENE-2-CARBOXYLIC ACID 1-benzothiophene-2-carboxylic acid 1-BENZOTHIOPHENE-2-CARBOXYLIC ACID Benzo(b)thiophene-2-carboxylic acid BENZO[B]THIOPHENE-2-CARBOXYLIC ACID Benzo[b]thiophene-2-carboxylic acid |
| CAS | 6314-28-9 |
| EINECS | 613-148-1 |
| InChI | InChI=1/C9H6O2S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H,(H,10,11)/p-1 |
| Molecular Formula | C9H6O2S |
| Molar Mass | 178.21 |
| Density | 1.3242 (rough estimate) |
| Melting Point | 241-244 °C (lit.) |
| Boling Point | 280.44°C (rough estimate) |
| Flash Point | 181.3°C |
| Water Solubility | Soluble in ethanol, acetone and chloroform. Insoluble in water. |
| Vapor Presure | 2.5E-06mmHg at 25°C |
| Merck | 14,9345 |
| BRN | 124613 |
| pKa | 3.48±0.30(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.5480 (estimate) |
| MDL | MFCD00051636 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Hazard Note | Irritant |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |